C22H26N2O4 — CID 38203835
N-[2-[[(E)-3-(3,4-diethoxyphenyl)prop-2-enoyl]amino]ethyl]benzamide (PubChem CID 38203835) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is N-[2-[[(E)-3-(3,4-diethoxyphenyl)prop-2-enoyl]amino]ethyl]benzamide.
| Compound Name | N-[2-[[(E)-3-(3,4-diethoxyphenyl)prop-2-enoyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 38203835 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | N-[2-[[(E)-3-(3,4-diethoxyphenyl)prop-2-enoyl]amino]ethyl]benzamide |
| SMILES | CCOc1ccc(/C=C/C(=O)NCCNC(=O)c2ccccc2)cc1OCC |
| InChI | InChI=1S/C22H26N2O4/c1-3-27-19-12-10-17(16-20(19)28-4-2)11-13-21(25)23-14-15-24-22(26)18-8-6-5-7-9-18/h5-13,16H,3-4,14-15H2,1-2H3,(H,23,25)(H,24,26)/b13-11+ |
| InChIKey | MXOUPSJAEZALOD-ACCUITESSA-N |
| XLogP | 3.04 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|