C28H30N2O5 — CID 42942947
(E)-3-[3-ethoxy-4-(2-phenoxyethoxy)phenyl]-N-(2-oxo-5,6,7,8-tetrahydro-1H-quinolin-5-yl)prop-2-enamide (PubChem CID 42942947) has the molecular formula C28H30N2O5 and a molecular weight of 474.56 g/mol. Its IUPAC name is (E)-3-[3-ethoxy-4-(2-phenoxyethoxy)phenyl]-N-(2-oxo-5,6,7,8-tetrahydro-1H-quinolin-5-yl)prop-2-enamide.
| Compound Name | (E)-3-[3-ethoxy-4-(2-phenoxyethoxy)phenyl]-N-(2-oxo-5,6,7,8-tetrahydro-1H-quinolin-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 42942947 |
| Molecular Formula | C28H30N2O5 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | (E)-3-[3-ethoxy-4-(2-phenoxyethoxy)phenyl]-N-(2-oxo-5,6,7,8-tetrahydro-1H-quinolin-5-yl)prop-2-enamide |
| SMILES | CCOc1cc(/C=C/C(=O)NC2CCCc3[nH]c(=O)ccc32)ccc1OCCOc1ccccc1 |
| InChI | InChI=1S/C28H30N2O5/c1-2-33-26-19-20(11-14-25(26)35-18-17-34-21-7-4-3-5-8-21)12-15-27(31)29-23-9-6-10-24-22(23)13-16-28(32)30-24/h3-5,7-8,11-16,19,23H,2,6,9-10,17-18H2,1H3,(H,29,31)(H,30,32)/b15-12+ |
| InChIKey | COMNJQYMJXURMB-NTCAYCPXSA-N |
| XLogP | 4.44 |
| TPSA | 89.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|