C21H31NO4 — CID 78767527
3-(4-butoxy-3-ethoxyphenyl)-N-(4-hydroxycyclohexyl)prop-2-enamide (PubChem CID 78767527) has the molecular formula C21H31NO4 and a molecular weight of 361.48 g/mol. Its IUPAC name is 3-(4-butoxy-3-ethoxyphenyl)-N-(4-hydroxycyclohexyl)prop-2-enamide.
| Compound Name | 3-(4-butoxy-3-ethoxyphenyl)-N-(4-hydroxycyclohexyl)prop-2-enamide |
|---|---|
| PubChem CID | 78767527 |
| Molecular Formula | C21H31NO4 |
| Molecular Weight | 361.48 g/mol |
| Exact Mass | 361.23 |
| IUPAC Name | 3-(4-butoxy-3-ethoxyphenyl)-N-(4-hydroxycyclohexyl)prop-2-enamide |
| SMILES | CCCCOc1ccc(C=CC(=O)NC2CCC(O)CC2)cc1OCC |
| InChI | InChI=1S/C21H31NO4/c1-3-5-14-26-19-12-6-16(15-20(19)25-4-2)7-13-21(24)22-17-8-10-18(23)11-9-17/h6-7,12-13,15,17-18,23H,3-5,8-11,14H2,1-2H3,(H,22,24) |
| InChIKey | DORVJUOXQHLLBQ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.48 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|