C20H29NO4 — CID 78767416
3-(4-butoxy-3-methoxyphenyl)-N-(4-hydroxycyclohexyl)prop-2-enamide (PubChem CID 78767416) has the molecular formula C20H29NO4 and a molecular weight of 347.46 g/mol. Its IUPAC name is 3-(4-butoxy-3-methoxyphenyl)-N-(4-hydroxycyclohexyl)prop-2-enamide.
| Compound Name | 3-(4-butoxy-3-methoxyphenyl)-N-(4-hydroxycyclohexyl)prop-2-enamide |
|---|---|
| PubChem CID | 78767416 |
| Molecular Formula | C20H29NO4 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | 3-(4-butoxy-3-methoxyphenyl)-N-(4-hydroxycyclohexyl)prop-2-enamide |
| SMILES | CCCCOc1ccc(C=CC(=O)NC2CCC(O)CC2)cc1OC |
| InChI | InChI=1S/C20H29NO4/c1-3-4-13-25-18-11-5-15(14-19(18)24-2)6-12-20(23)21-16-7-9-17(22)10-8-16/h5-6,11-12,14,16-17,22H,3-4,7-10,13H2,1-2H3,(H,21,23) |
| InChIKey | GQAYQHLGDYUWJC-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|