C21H28NNaO5 — CID 67752974
sodium 4-[2-methoxy-4-[3-[(4-methylcyclohexyl)amino]-3-oxoprop-1-enyl]phenoxy]butanoate (PubChem CID 67752974) has the molecular formula C21H28NNaO5 and a molecular weight of 397.45 g/mol. Its IUPAC name is sodium 4-[2-methoxy-4-[3-[(4-methylcyclohexyl)amino]-3-oxoprop-1-enyl]phenoxy]butanoate.
| Compound Name | sodium 4-[2-methoxy-4-[3-[(4-methylcyclohexyl)amino]-3-oxoprop-1-enyl]phenoxy]butanoate |
|---|---|
| PubChem CID | 67752974 |
| Molecular Formula | C21H28NNaO5 |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | sodium 4-[2-methoxy-4-[3-[(4-methylcyclohexyl)amino]-3-oxoprop-1-enyl]phenoxy]butanoate |
| SMILES | COc1cc(C=CC(=O)NC2CCC(C)CC2)ccc1OCCCC(=O)[O-].[Na+] |
| InChI | InChI=1S/C21H29NO5.Na/c1-15-5-9-17(10-6-15)22-20(23)12-8-16-7-11-18(19(14-16)26-2)27-13-3-4-21(24)25;/h7-8,11-12,14-15,17H,3-6,9-10,13H2,1-2H3,(H,22,23)(H,24,25);/q;+1/p-1 |
| InChIKey | YFYFZWVQMURFJY-UHFFFAOYSA-M |
| XLogP | -0.68 |
| TPSA | 87.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|