C32H45N3O11 — CID 67753060
bis((E)-but-2-enedioic acid);(E)-3-[3-methoxy-4-[2-(4-methylpiperazin-1-yl)ethoxy]phenyl]-N-(4-methylcyclohexyl)prop-2-enamide (PubChem CID 67753060) has the molecular formula C32H45N3O11 and a molecular weight of 647.72 g/mol. Its IUPAC name is bis((E)-but-2-enedioic acid);(E)-3-[3-methoxy-4-[2-(4-methylpiperazin-1-yl)ethoxy]phenyl]-N-(4-methylcyclohexyl)prop-2-enamide.
| Compound Name | bis((E)-but-2-enedioic acid);(E)-3-[3-methoxy-4-[2-(4-methylpiperazin-1-yl)ethoxy]phenyl]-N-(4-methylcyclohexyl)prop-2-enamide |
|---|---|
| PubChem CID | 67753060 |
| Molecular Formula | C32H45N3O11 |
| Molecular Weight | 647.72 g/mol |
| Exact Mass | 647.31 |
| IUPAC Name | bis((E)-but-2-enedioic acid);(E)-3-[3-methoxy-4-[2-(4-methylpiperazin-1-yl)ethoxy]phenyl]-N-(4-methylcyclohexyl)prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)NC2CCC(C)CC2)ccc1OCCN1CCN(C)CC1.O=C(O)/C=C/C(=O)O.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C24H37N3O3.2C4H4O4/c1-19-4-8-21(9-5-19)25-24(28)11-7-20-6-10-22(23(18-20)29-3)30-17-16-27-14-12-26(2)13-15-27;2*5-3(6)1-2-4(7)8/h6-7,10-11,18-19,21H,4-5,8-9,12-17H2,1-3H3,(H,25,28);2*1-2H,(H,5,6)(H,7,8)/b11-7+;2*2-1+ |
| InChIKey | MPGLFWSMGNGQIP-VHQAVKTPSA-N |
| XLogP | 2.45 |
| TPSA | 203.24 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.72 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|