C25H37ClN2O3 — CID 19004720
(E)-3-[4-[2-[bis(prop-2-enyl)amino]ethoxy]-3-methoxyphenyl]-N-(4-methylcyclohexyl)prop-2-enamide;hydrochloride (PubChem CID 19004720) has the molecular formula C25H37ClN2O3 and a molecular weight of 449.04 g/mol. Its IUPAC name is (E)-3-[4-[2-[bis(prop-2-enyl)amino]ethoxy]-3-methoxyphenyl]-N-(4-methylcyclohexyl)prop-2-enamide;hydrochloride.
| Compound Name | (E)-3-[4-[2-[bis(prop-2-enyl)amino]ethoxy]-3-methoxyphenyl]-N-(4-methylcyclohexyl)prop-2-enamide;hydrochloride |
|---|---|
| PubChem CID | 19004720 |
| Molecular Formula | C25H37ClN2O3 |
| Molecular Weight | 449.04 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | (E)-3-[4-[2-[bis(prop-2-enyl)amino]ethoxy]-3-methoxyphenyl]-N-(4-methylcyclohexyl)prop-2-enamide;hydrochloride |
| SMILES | C=CCN(CC=C)CCOc1ccc(/C=C/C(=O)NC2CCC(C)CC2)cc1OC.Cl |
| InChI | InChI=1S/C25H36N2O3.ClH/c1-5-15-27(16-6-2)17-18-30-23-13-9-21(19-24(23)29-4)10-14-25(28)26-22-11-7-20(3)8-12-22;/h5-6,9-10,13-14,19-20,22H,1-2,7-8,11-12,15-18H2,3-4H3,(H,26,28);1H/b14-10+; |
| InChIKey | PRBLWQPXWQRRQE-KMZJGFRYSA-N |
| XLogP | 4.88 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.04 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|