C20H29NO3 — CID 74514644
3-(3-methoxy-4-propan-2-yloxyphenyl)-N-(4-methylcyclohexyl)prop-2-enamide (PubChem CID 74514644) has the molecular formula C20H29NO3 and a molecular weight of 331.46 g/mol. Its IUPAC name is 3-(3-methoxy-4-propan-2-yloxyphenyl)-N-(4-methylcyclohexyl)prop-2-enamide.
| Compound Name | 3-(3-methoxy-4-propan-2-yloxyphenyl)-N-(4-methylcyclohexyl)prop-2-enamide |
|---|---|
| PubChem CID | 74514644 |
| Molecular Formula | C20H29NO3 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | 3-(3-methoxy-4-propan-2-yloxyphenyl)-N-(4-methylcyclohexyl)prop-2-enamide |
| SMILES | COc1cc(C=CC(=O)NC2CCC(C)CC2)ccc1OC(C)C |
| InChI | InChI=1S/C20H29NO3/c1-14(2)24-18-11-7-16(13-19(18)23-4)8-12-20(22)21-17-9-5-15(3)6-10-17/h7-8,11-15,17H,5-6,9-10H2,1-4H3,(H,21,22) |
| InChIKey | ZPTOULWKUBPHOO-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|