C22H32ClNO3 — CID 19004737
(E)-3-[4-(5-chloropentoxy)-3-methoxyphenyl]-N-(4-methylcyclohexyl)prop-2-enamide (PubChem CID 19004737) has the molecular formula C22H32ClNO3 and a molecular weight of 393.96 g/mol. Its IUPAC name is (E)-3-[4-(5-chloropentoxy)-3-methoxyphenyl]-N-(4-methylcyclohexyl)prop-2-enamide.
| Compound Name | (E)-3-[4-(5-chloropentoxy)-3-methoxyphenyl]-N-(4-methylcyclohexyl)prop-2-enamide |
|---|---|
| PubChem CID | 19004737 |
| Molecular Formula | C22H32ClNO3 |
| Molecular Weight | 393.96 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | (E)-3-[4-(5-chloropentoxy)-3-methoxyphenyl]-N-(4-methylcyclohexyl)prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)NC2CCC(C)CC2)ccc1OCCCCCCl |
| InChI | InChI=1S/C22H32ClNO3/c1-17-6-10-19(11-7-17)24-22(25)13-9-18-8-12-20(21(16-18)26-2)27-15-5-3-4-14-23/h8-9,12-13,16-17,19H,3-7,10-11,14-15H2,1-2H3,(H,24,25)/b13-9+ |
| InChIKey | PNJMNQWEUKUCIF-UKTHLTGXSA-N |
| XLogP | 5.19 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.96 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|