C27H40N2O5 — CID 19004746
ethyl 1-[2-[2-methoxy-4-[(E)-3-[(4-methylcyclohexyl)amino]-3-oxoprop-1-enyl]phenoxy]ethyl]piperidine-4-carboxylate (PubChem CID 19004746) has the molecular formula C27H40N2O5 and a molecular weight of 472.63 g/mol. Its IUPAC name is ethyl 1-[2-[2-methoxy-4-[(E)-3-[(4-methylcyclohexyl)amino]-3-oxoprop-1-enyl]phenoxy]ethyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[2-[2-methoxy-4-[(E)-3-[(4-methylcyclohexyl)amino]-3-oxoprop-1-enyl]phenoxy]ethyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 19004746 |
| Molecular Formula | C27H40N2O5 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.29 |
| IUPAC Name | ethyl 1-[2-[2-methoxy-4-[(E)-3-[(4-methylcyclohexyl)amino]-3-oxoprop-1-enyl]phenoxy]ethyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(CCOc2ccc(/C=C/C(=O)NC3CCC(C)CC3)cc2OC)CC1 |
| InChI | InChI=1S/C27H40N2O5/c1-4-33-27(31)22-13-15-29(16-14-22)17-18-34-24-11-7-21(19-25(24)32-3)8-12-26(30)28-23-9-5-20(2)6-10-23/h7-8,11-12,19-20,22-23H,4-6,9-10,13-18H2,1-3H3,(H,28,30)/b12-8+ |
| InChIKey | HJQJPRYUOTUCMN-XYOKQWHBSA-N |
| XLogP | 4.06 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|