C29H43N3O4 — CID 19004666
(E)-3-[3-methoxy-4-[2-oxo-2-(4-piperidin-1-ylpiperidin-1-yl)ethoxy]phenyl]-N-(4-methylcyclohexyl)prop-2-enamide (PubChem CID 19004666) has the molecular formula C29H43N3O4 and a molecular weight of 497.68 g/mol. Its IUPAC name is (E)-3-[3-methoxy-4-[2-oxo-2-(4-piperidin-1-ylpiperidin-1-yl)ethoxy]phenyl]-N-(4-methylcyclohexyl)prop-2-enamide.
| Compound Name | (E)-3-[3-methoxy-4-[2-oxo-2-(4-piperidin-1-ylpiperidin-1-yl)ethoxy]phenyl]-N-(4-methylcyclohexyl)prop-2-enamide |
|---|---|
| PubChem CID | 19004666 |
| Molecular Formula | C29H43N3O4 |
| Molecular Weight | 497.68 g/mol |
| Exact Mass | 497.33 |
| IUPAC Name | (E)-3-[3-methoxy-4-[2-oxo-2-(4-piperidin-1-ylpiperidin-1-yl)ethoxy]phenyl]-N-(4-methylcyclohexyl)prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)NC2CCC(C)CC2)ccc1OCC(=O)N1CCC(N2CCCCC2)CC1 |
| InChI | InChI=1S/C29H43N3O4/c1-22-6-10-24(11-7-22)30-28(33)13-9-23-8-12-26(27(20-23)35-2)36-21-29(34)32-18-14-25(15-19-32)31-16-4-3-5-17-31/h8-9,12-13,20,22,24-25H,3-7,10-11,14-19,21H2,1-2H3,(H,30,33)/b13-9+ |
| InChIKey | ZLFFHAYBNCGFJN-UKTHLTGXSA-N |
| XLogP | 4.26 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.68 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|