C21H34N2O3 — CID 142232731
ethane;2-(2-methoxyphenoxy)-1-(4-piperidin-1-ylpiperidin-1-yl)ethanone (PubChem CID 142232731) has the molecular formula C21H34N2O3 and a molecular weight of 362.51 g/mol. Its IUPAC name is ethane;2-(2-methoxyphenoxy)-1-(4-piperidin-1-ylpiperidin-1-yl)ethanone.
| Compound Name | ethane;2-(2-methoxyphenoxy)-1-(4-piperidin-1-ylpiperidin-1-yl)ethanone |
|---|---|
| PubChem CID | 142232731 |
| Molecular Formula | C21H34N2O3 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.26 |
| IUPAC Name | ethane;2-(2-methoxyphenoxy)-1-(4-piperidin-1-ylpiperidin-1-yl)ethanone |
| SMILES | CC.COc1ccccc1OCC(=O)N1CCC(N2CCCCC2)CC1 |
| InChI | InChI=1S/C19H28N2O3.C2H6/c1-23-17-7-3-4-8-18(17)24-15-19(22)21-13-9-16(10-14-21)20-11-5-2-6-12-20;1-2/h3-4,7-8,16H,2,5-6,9-15H2,1H3;1-2H3 |
| InChIKey | ZAJSACDPVGWEAM-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |