C18H24N2O4 — CID 113002547
N-cyclopropyl-1-[2-(2-methoxyphenoxy)acetyl]piperidine-4-carboxamide (PubChem CID 113002547) has the molecular formula C18H24N2O4 and a molecular weight of 332.40 g/mol. Its IUPAC name is N-cyclopropyl-1-[2-(2-methoxyphenoxy)acetyl]piperidine-4-carboxamide.
| Compound Name | N-cyclopropyl-1-[2-(2-methoxyphenoxy)acetyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 113002547 |
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | N-cyclopropyl-1-[2-(2-methoxyphenoxy)acetyl]piperidine-4-carboxamide |
| SMILES | COc1ccccc1OCC(=O)N1CCC(C(=O)NC2CC2)CC1 |
| InChI | InChI=1S/C18H24N2O4/c1-23-15-4-2-3-5-16(15)24-12-17(21)20-10-8-13(9-11-20)18(22)19-14-6-7-14/h2-5,13-14H,6-12H2,1H3,(H,19,22) |
| InChIKey | WLLZARPEIXPVCW-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |