C26H36N2O4 — CID 108551002
2-(1-adamantyl)-N-[1-[2-(2-methoxyphenoxy)acetyl]piperidin-4-yl]acetamide (PubChem CID 108551002) has the molecular formula C26H36N2O4 and a molecular weight of 440.58 g/mol. Its IUPAC name is 2-(1-adamantyl)-N-[1-[2-(2-methoxyphenoxy)acetyl]piperidin-4-yl]acetamide.
| Compound Name | 2-(1-adamantyl)-N-[1-[2-(2-methoxyphenoxy)acetyl]piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 108551002 |
| Molecular Formula | C26H36N2O4 |
| Molecular Weight | 440.58 g/mol |
| Exact Mass | 440.27 |
| IUPAC Name | 2-(1-adamantyl)-N-[1-[2-(2-methoxyphenoxy)acetyl]piperidin-4-yl]acetamide |
| SMILES | COc1ccccc1OCC(=O)N1CCC(NC(=O)CC23CC4CC(CC(C4)C2)C3)CC1 |
| InChI | InChI=1S/C26H36N2O4/c1-31-22-4-2-3-5-23(22)32-17-25(30)28-8-6-21(7-9-28)27-24(29)16-26-13-18-10-19(14-26)12-20(11-18)15-26/h2-5,18-21H,6-17H2,1H3,(H,27,29) |
| InChIKey | RLMXYNIHACKELY-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.58 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |