C22H25NO5 — CID 95711262
1-[(3S)-3-(2-methoxybenzoyl)piperidin-1-yl]-2-(2-methoxyphenoxy)ethanone (PubChem CID 95711262) has the molecular formula C22H25NO5 and a molecular weight of 383.44 g/mol. Its IUPAC name is 1-[(3S)-3-(2-methoxybenzoyl)piperidin-1-yl]-2-(2-methoxyphenoxy)ethanone.
| Compound Name | 1-[(3S)-3-(2-methoxybenzoyl)piperidin-1-yl]-2-(2-methoxyphenoxy)ethanone |
|---|---|
| PubChem CID | 95711262 |
| Molecular Formula | C22H25NO5 |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | 1-[(3S)-3-(2-methoxybenzoyl)piperidin-1-yl]-2-(2-methoxyphenoxy)ethanone |
| SMILES | COc1ccccc1OCC(=O)N1CCC[C@H](C(=O)c2ccccc2OC)C1 |
| InChI | InChI=1S/C22H25NO5/c1-26-18-10-4-3-9-17(18)22(25)16-8-7-13-23(14-16)21(24)15-28-20-12-6-5-11-19(20)27-2/h3-6,9-12,16H,7-8,13-15H2,1-2H3/t16-/m0/s1 |
| InChIKey | REFZHRNUZYSKOS-INIZCTEOSA-N |
| XLogP | 3.20 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |