C16H21NO5 — CID 108731344
methyl 1-[2-(2-methoxyphenoxy)acetyl]piperidine-3-carboxylate (PubChem CID 108731344) has the molecular formula C16H21NO5 and a molecular weight of 307.35 g/mol. Its IUPAC name is methyl 1-[2-(2-methoxyphenoxy)acetyl]piperidine-3-carboxylate.
| Compound Name | methyl 1-[2-(2-methoxyphenoxy)acetyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 108731344 |
| Molecular Formula | C16H21NO5 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | methyl 1-[2-(2-methoxyphenoxy)acetyl]piperidine-3-carboxylate |
| SMILES | COC(=O)C1CCCN(C(=O)COc2ccccc2OC)C1 |
| InChI | InChI=1S/C16H21NO5/c1-20-13-7-3-4-8-14(13)22-11-15(18)17-9-5-6-12(10-17)16(19)21-2/h3-4,7-8,12H,5-6,9-11H2,1-2H3 |
| InChIKey | JBLGAOBHBRGAII-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |