C15H18BrNO4 — CID 78918831
methyl 1-[2-(4-bromophenoxy)acetyl]piperidine-3-carboxylate (PubChem CID 78918831) has the molecular formula C15H18BrNO4 and a molecular weight of 356.22 g/mol. Its IUPAC name is methyl 1-[2-(4-bromophenoxy)acetyl]piperidine-3-carboxylate.
| Compound Name | methyl 1-[2-(4-bromophenoxy)acetyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 78918831 |
| Molecular Formula | C15H18BrNO4 |
| Molecular Weight | 356.22 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | methyl 1-[2-(4-bromophenoxy)acetyl]piperidine-3-carboxylate |
| SMILES | COC(=O)C1CCCN(C(=O)COc2ccc(Br)cc2)C1 |
| InChI | InChI=1S/C15H18BrNO4/c1-20-15(19)11-3-2-8-17(9-11)14(18)10-21-13-6-4-12(16)5-7-13/h4-7,11H,2-3,8-10H2,1H3 |
| InChIKey | IQULWYZYDAXLNO-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.22 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |