C16H20N2O5 — CID 119109496
methyl 1-[4-(2-amino-2-oxoethoxy)benzoyl]piperidine-3-carboxylate (PubChem CID 119109496) has the molecular formula C16H20N2O5 and a molecular weight of 320.35 g/mol. Its IUPAC name is methyl 1-[4-(2-amino-2-oxoethoxy)benzoyl]piperidine-3-carboxylate.
| Compound Name | methyl 1-[4-(2-amino-2-oxoethoxy)benzoyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 119109496 |
| Molecular Formula | C16H20N2O5 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | methyl 1-[4-(2-amino-2-oxoethoxy)benzoyl]piperidine-3-carboxylate |
| SMILES | COC(=O)C1CCCN(C(=O)c2ccc(OCC(N)=O)cc2)C1 |
| InChI | InChI=1S/C16H20N2O5/c1-22-16(21)12-3-2-8-18(9-12)15(20)11-4-6-13(7-5-11)23-10-14(17)19/h4-7,12H,2-3,8-10H2,1H3,(H2,17,19) |
| InChIKey | VWDREQKKKAMORL-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |