C14H17BrN2O4 — CID 78919229
methyl 1-[2-(5-bromo-2-oxo-1-pyridinyl)acetyl]piperidine-3-carboxylate (PubChem CID 78919229) has the molecular formula C14H17BrN2O4 and a molecular weight of 357.20 g/mol. Its IUPAC name is methyl 1-[2-(5-bromo-2-oxo-1-pyridinyl)acetyl]piperidine-3-carboxylate.
| Compound Name | methyl 1-[2-(5-bromo-2-oxo-1-pyridinyl)acetyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 78919229 |
| Molecular Formula | C14H17BrN2O4 |
| Molecular Weight | 357.20 g/mol |
| Exact Mass | 356.04 |
| IUPAC Name | methyl 1-[2-(5-bromo-2-oxo-1-pyridinyl)acetyl]piperidine-3-carboxylate |
| SMILES | COC(=O)C1CCCN(C(=O)Cn2cc(Br)ccc2=O)C1 |
| InChI | InChI=1S/C14H17BrN2O4/c1-21-14(20)10-3-2-6-16(7-10)13(19)9-17-8-11(15)4-5-12(17)18/h4-5,8,10H,2-3,6-7,9H2,1H3 |
| InChIKey | ODNKJJNBFRNURJ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 68.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.20 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |