About 5-bromo-1-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl]pyridin-2-one
5-bromo-1-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl]pyridin-2-one (PubChem CID 94155096) has the molecular formula C13H17BrN2O3
and a molecular weight of 329.19 g/mol. Its IUPAC name is 5-bromo-1-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl]pyridin-2-one.
Molecular Properties
| Compound Name | 5-bromo-1-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl]pyridin-2-one |
| PubChem CID | 94155096 |
| Molecular Formula | C13H17BrN2O3 |
| Molecular Weight | 329.19 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | 5-bromo-1-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl]pyridin-2-one |
| SMILES | C[C@@H]1CN(C(=O)Cn2cc(Br)ccc2=O)C[C@H](C)O1 |
| InChI | InChI=1S/C13H17BrN2O3/c1-9-5-15(6-10(2)19-9)13(18)8-16-7-11(14)3-4-12(16)17/h3-4,7,9-10H,5-6,8H2,1-2H3/t9-,10+ |
| InChIKey | HBAZFNAVCLLSOD-AOOOYVTPSA-N |
| XLogP | 1.25 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.19 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-bromo-1-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl]pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-1-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl]pyridin-2-one?
The IUPAC name of 5-bromo-1-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl]pyridin-2-one (CID 94155096) is 5-bromo-1-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl]pyridin-2-one.
What is the SMILES notation for 5-bromo-1-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl]pyridin-2-one?
The canonical SMILES for 5-bromo-1-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl]pyridin-2-one is C[C@@H]1CN(C(=O)Cn2cc(Br)ccc2=O)C[C@H](C)O1.
What is the InChIKey of 5-bromo-1-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl]pyridin-2-one?
The InChIKey is HBAZFNAVCLLSOD-AOOOYVTPSA-N. The full InChI is InChI=1S/C13H17BrN2O3/c1-9-5-15(6-10(2)19-9)13(18)8-16-7-11(14)3-4-12(16)17/h3-4,7,9-10H,5-6,8H2,1-2H3/t9-,10+.
What are the key properties of 5-bromo-1-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl]pyridin-2-one?
5-bromo-1-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl]pyridin-2-one has a molecular weight of 329.19 g/mol, XLogP of 1.25, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-1-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl]pyridin-2-one is sourced from PubChem (CID 94155096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).