C20H22N2O3S — CID 42293000
1-[(3S)-3-(2-methoxybenzoyl)piperidin-1-yl]-2-pyridin-2-ylsulfanylethanone (PubChem CID 42293000) has the molecular formula C20H22N2O3S and a molecular weight of 370.47 g/mol. Its IUPAC name is 1-[(3S)-3-(2-methoxybenzoyl)piperidin-1-yl]-2-pyridin-2-ylsulfanylethanone.
| Compound Name | 1-[(3S)-3-(2-methoxybenzoyl)piperidin-1-yl]-2-pyridin-2-ylsulfanylethanone |
|---|---|
| PubChem CID | 42293000 |
| Molecular Formula | C20H22N2O3S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 1-[(3S)-3-(2-methoxybenzoyl)piperidin-1-yl]-2-pyridin-2-ylsulfanylethanone |
| SMILES | COc1ccccc1C(=O)[C@H]1CCCN(C(=O)CSc2ccccn2)C1 |
| InChI | InChI=1S/C20H22N2O3S/c1-25-17-9-3-2-8-16(17)20(24)15-7-6-12-22(13-15)19(23)14-26-18-10-4-5-11-21-18/h2-5,8-11,15H,6-7,12-14H2,1H3/t15-/m0/s1 |
| InChIKey | OYIHQTQJEFTTFZ-HNNXBMFYSA-N |
| XLogP | 3.30 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |