C22H25NO5 — CID 95725717
[(3S)-1-(2,3-dimethoxybenzoyl)piperidin-3-yl]-(2-methoxyphenyl)methanone (PubChem CID 95725717) has the molecular formula C22H25NO5 and a molecular weight of 383.44 g/mol. Its IUPAC name is [(3S)-1-(2,3-dimethoxybenzoyl)piperidin-3-yl]-(2-methoxyphenyl)methanone.
| Compound Name | [(3S)-1-(2,3-dimethoxybenzoyl)piperidin-3-yl]-(2-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 95725717 |
| Molecular Formula | C22H25NO5 |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | [(3S)-1-(2,3-dimethoxybenzoyl)piperidin-3-yl]-(2-methoxyphenyl)methanone |
| SMILES | COc1ccccc1C(=O)[C@H]1CCCN(C(=O)c2cccc(OC)c2OC)C1 |
| InChI | InChI=1S/C22H25NO5/c1-26-18-11-5-4-9-16(18)20(24)15-8-7-13-23(14-15)22(25)17-10-6-12-19(27-2)21(17)28-3/h4-6,9-12,15H,7-8,13-14H2,1-3H3/t15-/m0/s1 |
| InChIKey | VWJXOEMEXXWZTA-HNNXBMFYSA-N |
| XLogP | 3.45 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |