C24H39ClN2NaO3 — CID 67753006
CID 67753006 (PubChem CID 67753006) has the molecular formula C24H39ClN2NaO3 and a molecular weight of 462.03 g/mol.
| Compound Name | CID 67753006 |
|---|---|
| PubChem CID | 67753006 |
| Molecular Formula | C24H39ClN2NaO3 |
| Molecular Weight | 462.03 g/mol |
| Exact Mass | 461.25 |
| IUPAC Name | — |
| SMILES | COc1cc(C=CC(=O)NC2CCC(C)CC2)ccc1OCCCCCN(C)C.Cl.[Na] |
| InChI | InChI=1S/C24H38N2O3.ClH.Na/c1-19-8-12-21(13-9-19)25-24(27)15-11-20-10-14-22(23(18-20)28-4)29-17-7-5-6-16-26(2)3;;/h10-11,14-15,18-19,21H,5-9,12-13,16-17H2,1-4H3,(H,25,27);1H; |
| InChIKey | YPOMNMYBUPZTIM-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.03 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|