C22H30ClN3O3 — CID 67753243
(E)-3-[3-methoxy-4-[2-(1H-pyrazol-5-yl)ethoxy]phenyl]-N-(4-methylcyclohexyl)prop-2-enamide;hydrochloride (PubChem CID 67753243) has the molecular formula C22H30ClN3O3 and a molecular weight of 419.95 g/mol. Its IUPAC name is (E)-3-[3-methoxy-4-[2-(1H-pyrazol-5-yl)ethoxy]phenyl]-N-(4-methylcyclohexyl)prop-2-enamide;hydrochloride.
| Compound Name | (E)-3-[3-methoxy-4-[2-(1H-pyrazol-5-yl)ethoxy]phenyl]-N-(4-methylcyclohexyl)prop-2-enamide;hydrochloride |
|---|---|
| PubChem CID | 67753243 |
| Molecular Formula | C22H30ClN3O3 |
| Molecular Weight | 419.95 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | (E)-3-[3-methoxy-4-[2-(1H-pyrazol-5-yl)ethoxy]phenyl]-N-(4-methylcyclohexyl)prop-2-enamide;hydrochloride |
| SMILES | COc1cc(/C=C/C(=O)NC2CCC(C)CC2)ccc1OCCc1ccn[nH]1.Cl |
| InChI | InChI=1S/C22H29N3O3.ClH/c1-16-3-7-18(8-4-16)24-22(26)10-6-17-5-9-20(21(15-17)27-2)28-14-12-19-11-13-23-25-19;/h5-6,9-11,13,15-16,18H,3-4,7-8,12,14H2,1-2H3,(H,23,25)(H,24,26);1H/b10-6+; |
| InChIKey | DZSLVKBTFYVHDY-AAGWESIMSA-N |
| XLogP | 4.17 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.95 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|