C17H22NNaO3 — CID 67752639
sodium 2-methoxy-4-[3-[(4-methylcyclohexyl)amino]-3-oxoprop-1-enyl]phenolate (PubChem CID 67752639) has the molecular formula C17H22NNaO3 and a molecular weight of 311.36 g/mol. Its IUPAC name is sodium 2-methoxy-4-[3-[(4-methylcyclohexyl)amino]-3-oxoprop-1-enyl]phenolate.
| Compound Name | sodium 2-methoxy-4-[3-[(4-methylcyclohexyl)amino]-3-oxoprop-1-enyl]phenolate |
|---|---|
| PubChem CID | 67752639 |
| Molecular Formula | C17H22NNaO3 |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | sodium 2-methoxy-4-[3-[(4-methylcyclohexyl)amino]-3-oxoprop-1-enyl]phenolate |
| SMILES | COc1cc(C=CC(=O)NC2CCC(C)CC2)ccc1[O-].[Na+] |
| InChI | InChI=1S/C17H23NO3.Na/c1-12-3-7-14(8-4-12)18-17(20)10-6-13-5-9-15(19)16(11-13)21-2;/h5-6,9-12,14,19H,3-4,7-8H2,1-2H3,(H,18,20);/q;+1/p-1 |
| InChIKey | FGTWIFBRULSLFX-UHFFFAOYSA-M |
| XLogP | -0.52 |
| TPSA | 61.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|