C18H26N2O4 — CID 39102581
(E)-3-[3-ethoxy-4-[2-(4-methylpiperazin-1-yl)ethoxy]phenyl]prop-2-enoic acid (PubChem CID 39102581) has the molecular formula C18H26N2O4 and a molecular weight of 334.42 g/mol. Its IUPAC name is (E)-3-[3-ethoxy-4-[2-(4-methylpiperazin-1-yl)ethoxy]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-ethoxy-4-[2-(4-methylpiperazin-1-yl)ethoxy]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 39102581 |
| Molecular Formula | C18H26N2O4 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | (E)-3-[3-ethoxy-4-[2-(4-methylpiperazin-1-yl)ethoxy]phenyl]prop-2-enoic acid |
| SMILES | CCOc1cc(/C=C/C(=O)O)ccc1OCCN1CCN(C)CC1 |
| InChI | InChI=1S/C18H26N2O4/c1-3-23-17-14-15(5-7-18(21)22)4-6-16(17)24-13-12-20-10-8-19(2)9-11-20/h4-7,14H,3,8-13H2,1-2H3,(H,21,22)/b7-5+ |
| InChIKey | MAXIJCAWXRVEJC-FNORWQNLSA-N |
| XLogP | 1.81 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|