C19H27Cl3O4Si — CID 67577148
3-[3-ethoxy-4-(8-trichlorosilyloctoxy)phenyl]prop-2-enoic acid (PubChem CID 67577148) has the molecular formula C19H27Cl3O4Si and a molecular weight of 453.87 g/mol. Its IUPAC name is 3-[3-ethoxy-4-(8-trichlorosilyloctoxy)phenyl]prop-2-enoic acid.
| Compound Name | 3-[3-ethoxy-4-(8-trichlorosilyloctoxy)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 67577148 |
| Molecular Formula | C19H27Cl3O4Si |
| Molecular Weight | 453.87 g/mol |
| Exact Mass | 452.07 |
| IUPAC Name | 3-[3-ethoxy-4-(8-trichlorosilyloctoxy)phenyl]prop-2-enoic acid |
| SMILES | CCOc1cc(C=CC(=O)O)ccc1OCCCCCCCC[Si](Cl)(Cl)Cl |
| InChI | InChI=1S/C19H27Cl3O4Si/c1-2-25-18-15-16(10-12-19(23)24)9-11-17(18)26-13-7-5-3-4-6-8-14-27(20,21)22/h9-12,15H,2-8,13-14H2,1H3,(H,23,24) |
| InChIKey | OSFQMILVHHQHBO-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.87 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|