C14H15ClO4 — CID 29018211
(E)-3-[4-[(E)-3-chloroprop-2-enoxy]-3-ethoxyphenyl]prop-2-enoic acid (PubChem CID 29018211) has the molecular formula C14H15ClO4 and a molecular weight of 282.72 g/mol. Its IUPAC name is (E)-3-[4-[(E)-3-chloroprop-2-enoxy]-3-ethoxyphenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[(E)-3-chloroprop-2-enoxy]-3-ethoxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 29018211 |
| Molecular Formula | C14H15ClO4 |
| Molecular Weight | 282.72 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | (E)-3-[4-[(E)-3-chloroprop-2-enoxy]-3-ethoxyphenyl]prop-2-enoic acid |
| SMILES | CCOc1cc(/C=C/C(=O)O)ccc1OC/C=C/Cl |
| InChI | InChI=1S/C14H15ClO4/c1-2-18-13-10-11(5-7-14(16)17)4-6-12(13)19-9-3-8-15/h3-8,10H,2,9H2,1H3,(H,16,17)/b7-5+,8-3+ |
| InChIKey | ZJFLYNOZNOAYSQ-FAFCXXFBSA-N |
| XLogP | 3.31 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.72 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|