C18H25Cl3O4Si — CID 140988185
7-trichlorosilylheptyl (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate (PubChem CID 140988185) has the molecular formula C18H25Cl3O4Si and a molecular weight of 439.84 g/mol. Its IUPAC name is 7-trichlorosilylheptyl (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate.
| Compound Name | 7-trichlorosilylheptyl (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 140988185 |
| Molecular Formula | C18H25Cl3O4Si |
| Molecular Weight | 439.84 g/mol |
| Exact Mass | 438.06 |
| IUPAC Name | 7-trichlorosilylheptyl (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(/C=C/C(=O)OCCCCCCC[Si](Cl)(Cl)Cl)cc1OC |
| InChI | InChI=1S/C18H25Cl3O4Si/c1-23-16-10-8-15(14-17(16)24-2)9-11-18(22)25-12-6-4-3-5-7-13-26(19,20)21/h8-11,14H,3-7,12-13H2,1-2H3/b11-9+ |
| InChIKey | UGCRZZWVKCBNRS-PKNBQFBNSA-N |
| XLogP | 5.87 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.84 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|