C19H25NO5 — CID 7753371
[(2R)-1-(cyclopropylamino)-1-oxopropan-2-yl] (E)-3-(3,4-diethoxyphenyl)prop-2-enoate (PubChem CID 7753371) has the molecular formula C19H25NO5 and a molecular weight of 347.41 g/mol. Its IUPAC name is [(2R)-1-(cyclopropylamino)-1-oxopropan-2-yl] (E)-3-(3,4-diethoxyphenyl)prop-2-enoate.
| Compound Name | [(2R)-1-(cyclopropylamino)-1-oxopropan-2-yl] (E)-3-(3,4-diethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7753371 |
| Molecular Formula | C19H25NO5 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | [(2R)-1-(cyclopropylamino)-1-oxopropan-2-yl] (E)-3-(3,4-diethoxyphenyl)prop-2-enoate |
| SMILES | CCOc1ccc(/C=C/C(=O)O[C@H](C)C(=O)NC2CC2)cc1OCC |
| InChI | InChI=1S/C19H25NO5/c1-4-23-16-10-6-14(12-17(16)24-5-2)7-11-18(21)25-13(3)19(22)20-15-8-9-15/h6-7,10-13,15H,4-5,8-9H2,1-3H3,(H,20,22)/b11-7+/t13-/m1/s1 |
| InChIKey | NZDYESLMMRQOCM-SVTZGKHISA-N |
| XLogP | 2.71 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|