C22H23F2NO5 — CID 8984635
[(2R)-1-(3,4-difluoroanilino)-1-oxopropan-2-yl] (E)-3-(3,4-diethoxyphenyl)prop-2-enoate (PubChem CID 8984635) has the molecular formula C22H23F2NO5 and a molecular weight of 419.42 g/mol. Its IUPAC name is [(2R)-1-(3,4-difluoroanilino)-1-oxopropan-2-yl] (E)-3-(3,4-diethoxyphenyl)prop-2-enoate.
| Compound Name | [(2R)-1-(3,4-difluoroanilino)-1-oxopropan-2-yl] (E)-3-(3,4-diethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 8984635 |
| Molecular Formula | C22H23F2NO5 |
| Molecular Weight | 419.42 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | [(2R)-1-(3,4-difluoroanilino)-1-oxopropan-2-yl] (E)-3-(3,4-diethoxyphenyl)prop-2-enoate |
| SMILES | CCOc1ccc(/C=C/C(=O)O[C@H](C)C(=O)Nc2ccc(F)c(F)c2)cc1OCC |
| InChI | InChI=1S/C22H23F2NO5/c1-4-28-19-10-6-15(12-20(19)29-5-2)7-11-21(26)30-14(3)22(27)25-16-8-9-17(23)18(24)13-16/h6-14H,4-5H2,1-3H3,(H,25,27)/b11-7+/t14-/m1/s1 |
| InChIKey | AZSSJRABKHJQLS-DPQIITEBSA-N |
| XLogP | 4.35 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.42 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|