C18H18F2N2O3 — CID 129420682
(2S)-N-(3,4-difluorophenyl)-2-[(4-ethoxyphenyl)methylideneamino]oxypropanamide (PubChem CID 129420682) has the molecular formula C18H18F2N2O3 and a molecular weight of 348.35 g/mol. Its IUPAC name is (2S)-N-(3,4-difluorophenyl)-2-[(4-ethoxyphenyl)methylideneamino]oxypropanamide.
| Compound Name | (2S)-N-(3,4-difluorophenyl)-2-[(4-ethoxyphenyl)methylideneamino]oxypropanamide |
|---|---|
| PubChem CID | 129420682 |
| Molecular Formula | C18H18F2N2O3 |
| Molecular Weight | 348.35 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | (2S)-N-(3,4-difluorophenyl)-2-[(4-ethoxyphenyl)methylideneamino]oxypropanamide |
| SMILES | CCOc1ccc(C=NO[C@@H](C)C(=O)Nc2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C18H18F2N2O3/c1-3-24-15-7-4-13(5-8-15)11-21-25-12(2)18(23)22-14-6-9-16(19)17(20)10-14/h4-12H,3H2,1-2H3,(H,22,23)/t12-/m0/s1 |
| InChIKey | IQNLYDWTVUNPAB-LBPRGKRZSA-N |
| XLogP | 3.74 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.35 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|