C27H33NO5 — CID 16543446
[1-oxo-1-(1,2,3,4-tetrahydronaphthalen-1-ylamino)propan-2-yl] (E)-3-(3-ethoxy-4-propoxyphenyl)prop-2-enoate (PubChem CID 16543446) has the molecular formula C27H33NO5 and a molecular weight of 451.56 g/mol. Its IUPAC name is [1-oxo-1-(1,2,3,4-tetrahydronaphthalen-1-ylamino)propan-2-yl] (E)-3-(3-ethoxy-4-propoxyphenyl)prop-2-enoate.
| Compound Name | [1-oxo-1-(1,2,3,4-tetrahydronaphthalen-1-ylamino)propan-2-yl] (E)-3-(3-ethoxy-4-propoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 16543446 |
| Molecular Formula | C27H33NO5 |
| Molecular Weight | 451.56 g/mol |
| Exact Mass | 451.24 |
| IUPAC Name | [1-oxo-1-(1,2,3,4-tetrahydronaphthalen-1-ylamino)propan-2-yl] (E)-3-(3-ethoxy-4-propoxyphenyl)prop-2-enoate |
| SMILES | CCCOc1ccc(/C=C/C(=O)OC(C)C(=O)NC2CCCc3ccccc32)cc1OCC |
| InChI | InChI=1S/C27H33NO5/c1-4-17-32-24-15-13-20(18-25(24)31-5-2)14-16-26(29)33-19(3)27(30)28-23-12-8-10-21-9-6-7-11-22(21)23/h6-7,9,11,13-16,18-19,23H,4-5,8,10,12,17H2,1-3H3,(H,28,30)/b16-14+ |
| InChIKey | PICSGLKBIYMMGL-JQIJEIRASA-N |
| XLogP | 5.01 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.56 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|