C18H24F2N2O5S — CID 46566499
(E)-3-[4-(difluoromethoxy)-3-ethoxyphenyl]-N-(1-methylsulfonylpiperidin-4-yl)prop-2-enamide (PubChem CID 46566499) has the molecular formula C18H24F2N2O5S and a molecular weight of 418.46 g/mol. Its IUPAC name is (E)-3-[4-(difluoromethoxy)-3-ethoxyphenyl]-N-(1-methylsulfonylpiperidin-4-yl)prop-2-enamide.
| Compound Name | (E)-3-[4-(difluoromethoxy)-3-ethoxyphenyl]-N-(1-methylsulfonylpiperidin-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 46566499 |
| Molecular Formula | C18H24F2N2O5S |
| Molecular Weight | 418.46 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | (E)-3-[4-(difluoromethoxy)-3-ethoxyphenyl]-N-(1-methylsulfonylpiperidin-4-yl)prop-2-enamide |
| SMILES | CCOc1cc(/C=C/C(=O)NC2CCN(S(C)(=O)=O)CC2)ccc1OC(F)F |
| InChI | InChI=1S/C18H24F2N2O5S/c1-3-26-16-12-13(4-6-15(16)27-18(19)20)5-7-17(23)21-14-8-10-22(11-9-14)28(2,24)25/h4-7,12,14,18H,3,8-11H2,1-2H3,(H,21,23)/b7-5+ |
| InChIKey | GAFAWRUXAVDUEC-FNORWQNLSA-N |
| XLogP | 2.24 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.46 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|