C21H27F2NO5 — CID 75136642
methyl 1-[3-[4-(difluoromethoxy)-3-ethoxyphenyl]prop-2-enoylamino]-4-methylcyclohexane-1-carboxylate (PubChem CID 75136642) has the molecular formula C21H27F2NO5 and a molecular weight of 411.45 g/mol. Its IUPAC name is methyl 1-[3-[4-(difluoromethoxy)-3-ethoxyphenyl]prop-2-enoylamino]-4-methylcyclohexane-1-carboxylate.
| Compound Name | methyl 1-[3-[4-(difluoromethoxy)-3-ethoxyphenyl]prop-2-enoylamino]-4-methylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 75136642 |
| Molecular Formula | C21H27F2NO5 |
| Molecular Weight | 411.45 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | methyl 1-[3-[4-(difluoromethoxy)-3-ethoxyphenyl]prop-2-enoylamino]-4-methylcyclohexane-1-carboxylate |
| SMILES | CCOc1cc(C=CC(=O)NC2(C(=O)OC)CCC(C)CC2)ccc1OC(F)F |
| InChI | InChI=1S/C21H27F2NO5/c1-4-28-17-13-15(5-7-16(17)29-20(22)23)6-8-18(25)24-21(19(26)27-3)11-9-14(2)10-12-21/h5-8,13-14,20H,4,9-12H2,1-3H3,(H,24,25) |
| InChIKey | SMGCTYCFFANSRN-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.45 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|