C21H23F2NO5 — CID 55594874
(E)-3-[4-(difluoromethoxy)-3-ethoxyphenyl]-N-[(2,3-dimethoxyphenyl)methyl]prop-2-enamide (PubChem CID 55594874) has the molecular formula C21H23F2NO5 and a molecular weight of 407.41 g/mol. Its IUPAC name is (E)-3-[4-(difluoromethoxy)-3-ethoxyphenyl]-N-[(2,3-dimethoxyphenyl)methyl]prop-2-enamide.
| Compound Name | (E)-3-[4-(difluoromethoxy)-3-ethoxyphenyl]-N-[(2,3-dimethoxyphenyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 55594874 |
| Molecular Formula | C21H23F2NO5 |
| Molecular Weight | 407.41 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | (E)-3-[4-(difluoromethoxy)-3-ethoxyphenyl]-N-[(2,3-dimethoxyphenyl)methyl]prop-2-enamide |
| SMILES | CCOc1cc(/C=C/C(=O)NCc2cccc(OC)c2OC)ccc1OC(F)F |
| InChI | InChI=1S/C21H23F2NO5/c1-4-28-18-12-14(8-10-16(18)29-21(22)23)9-11-19(25)24-13-15-6-5-7-17(26-2)20(15)27-3/h5-12,21H,4,13H2,1-3H3,(H,24,25)/b11-9+ |
| InChIKey | LLBXXYKKLBOQPV-PKNBQFBNSA-N |
| XLogP | 4.03 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.41 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|