C24H28F2N2O3 — CID 94717552
(E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]-N-[1-[(3-methylphenyl)methyl]piperidin-4-yl]prop-2-enamide (PubChem CID 94717552) has the molecular formula C24H28F2N2O3 and a molecular weight of 430.50 g/mol. Its IUPAC name is (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]-N-[1-[(3-methylphenyl)methyl]piperidin-4-yl]prop-2-enamide.
| Compound Name | (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]-N-[1-[(3-methylphenyl)methyl]piperidin-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 94717552 |
| Molecular Formula | C24H28F2N2O3 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]-N-[1-[(3-methylphenyl)methyl]piperidin-4-yl]prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)NC2CCN(Cc3cccc(C)c3)CC2)ccc1OC(F)F |
| InChI | InChI=1S/C24H28F2N2O3/c1-17-4-3-5-19(14-17)16-28-12-10-20(11-13-28)27-23(29)9-7-18-6-8-21(31-24(25)26)22(15-18)30-2/h3-9,14-15,20,24H,10-13,16H2,1-2H3,(H,27,29)/b9-7+ |
| InChIKey | CQKFPMVHYPULGE-VQHVLOKHSA-N |
| XLogP | 4.40 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|