C26H33NO6S — CID 55330276
(E)-N-(1,1-dioxothiolan-3-yl)-3-[3-ethoxy-4-(2-phenoxyethoxy)phenyl]-N-propylprop-2-enamide (PubChem CID 55330276) has the molecular formula C26H33NO6S and a molecular weight of 487.62 g/mol. Its IUPAC name is (E)-N-(1,1-dioxothiolan-3-yl)-3-[3-ethoxy-4-(2-phenoxyethoxy)phenyl]-N-propylprop-2-enamide.
| Compound Name | (E)-N-(1,1-dioxothiolan-3-yl)-3-[3-ethoxy-4-(2-phenoxyethoxy)phenyl]-N-propylprop-2-enamide |
|---|---|
| PubChem CID | 55330276 |
| Molecular Formula | C26H33NO6S |
| Molecular Weight | 487.62 g/mol |
| Exact Mass | 487.20 |
| IUPAC Name | (E)-N-(1,1-dioxothiolan-3-yl)-3-[3-ethoxy-4-(2-phenoxyethoxy)phenyl]-N-propylprop-2-enamide |
| SMILES | CCCN(C(=O)/C=C/c1ccc(OCCOc2ccccc2)c(OCC)c1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C26H33NO6S/c1-3-15-27(22-14-18-34(29,30)20-22)26(28)13-11-21-10-12-24(25(19-21)31-4-2)33-17-16-32-23-8-6-5-7-9-23/h5-13,19,22H,3-4,14-18,20H2,1-2H3/b13-11+ |
| InChIKey | ASFQVOVSYVKIRU-ACCUITESSA-N |
| XLogP | 3.98 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.62 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|