C17H21F2NO5S — CID 46558587
(E)-3-[4-(difluoromethoxy)-3-ethoxyphenyl]-N-(1,1-dioxothiolan-3-yl)-N-methylprop-2-enamide (PubChem CID 46558587) has the molecular formula C17H21F2NO5S and a molecular weight of 389.42 g/mol. Its IUPAC name is (E)-3-[4-(difluoromethoxy)-3-ethoxyphenyl]-N-(1,1-dioxothiolan-3-yl)-N-methylprop-2-enamide.
| Compound Name | (E)-3-[4-(difluoromethoxy)-3-ethoxyphenyl]-N-(1,1-dioxothiolan-3-yl)-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 46558587 |
| Molecular Formula | C17H21F2NO5S |
| Molecular Weight | 389.42 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | (E)-3-[4-(difluoromethoxy)-3-ethoxyphenyl]-N-(1,1-dioxothiolan-3-yl)-N-methylprop-2-enamide |
| SMILES | CCOc1cc(/C=C/C(=O)N(C)C2CCS(=O)(=O)C2)ccc1OC(F)F |
| InChI | InChI=1S/C17H21F2NO5S/c1-3-24-15-10-12(4-6-14(15)25-17(18)19)5-7-16(21)20(2)13-8-9-26(22,23)11-13/h4-7,10,13,17H,3,8-9,11H2,1-2H3/b7-5+ |
| InChIKey | UAQZORCXOSEEOV-FNORWQNLSA-N |
| XLogP | 2.35 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.42 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|