C23H25NO4S — CID 60560664
(E)-N-(1,1-dioxothiolan-3-yl)-3-(3-phenylmethoxyphenyl)-N-prop-2-enylprop-2-enamide (PubChem CID 60560664) has the molecular formula C23H25NO4S and a molecular weight of 411.52 g/mol. Its IUPAC name is (E)-N-(1,1-dioxothiolan-3-yl)-3-(3-phenylmethoxyphenyl)-N-prop-2-enylprop-2-enamide.
| Compound Name | (E)-N-(1,1-dioxothiolan-3-yl)-3-(3-phenylmethoxyphenyl)-N-prop-2-enylprop-2-enamide |
|---|---|
| PubChem CID | 60560664 |
| Molecular Formula | C23H25NO4S |
| Molecular Weight | 411.52 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | (E)-N-(1,1-dioxothiolan-3-yl)-3-(3-phenylmethoxyphenyl)-N-prop-2-enylprop-2-enamide |
| SMILES | C=CCN(C(=O)/C=C/c1cccc(OCc2ccccc2)c1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C23H25NO4S/c1-2-14-24(21-13-15-29(26,27)18-21)23(25)12-11-19-9-6-10-22(16-19)28-17-20-7-4-3-5-8-20/h2-12,16,21H,1,13-15,17-18H2/b12-11+ |
| InChIKey | BFVNLZQCUGNSBM-VAWYXSNFSA-N |
| XLogP | 3.48 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.52 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|