C21H24N2O4S2 — CID 60560733
(E)-N-(1,1-dioxothiolan-3-yl)-3-[2-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]-N-prop-2-enylprop-2-enamide (PubChem CID 60560733) has the molecular formula C21H24N2O4S2 and a molecular weight of 432.57 g/mol. Its IUPAC name is (E)-N-(1,1-dioxothiolan-3-yl)-3-[2-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]-N-prop-2-enylprop-2-enamide.
| Compound Name | (E)-N-(1,1-dioxothiolan-3-yl)-3-[2-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]-N-prop-2-enylprop-2-enamide |
|---|---|
| PubChem CID | 60560733 |
| Molecular Formula | C21H24N2O4S2 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | (E)-N-(1,1-dioxothiolan-3-yl)-3-[2-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]-N-prop-2-enylprop-2-enamide |
| SMILES | C=CCN(C(=O)/C=C/c1ccccc1OCc1csc(C)n1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C21H24N2O4S2/c1-3-11-23(19-10-12-29(25,26)15-19)21(24)9-8-17-6-4-5-7-20(17)27-13-18-14-28-16(2)22-18/h3-9,14,19H,1,10-13,15H2,2H3/b9-8+ |
| InChIKey | BZLJTOYXLBLWNL-CMDGGOBGSA-N |
| XLogP | 3.25 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|