C24H22N2O2S3 — CID 31840850
(E)-3-[2-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]-N,N-bis(thiophen-2-ylmethyl)prop-2-enamide (PubChem CID 31840850) has the molecular formula C24H22N2O2S3 and a molecular weight of 466.65 g/mol. Its IUPAC name is (E)-3-[2-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]-N,N-bis(thiophen-2-ylmethyl)prop-2-enamide.
| Compound Name | (E)-3-[2-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]-N,N-bis(thiophen-2-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 31840850 |
| Molecular Formula | C24H22N2O2S3 |
| Molecular Weight | 466.65 g/mol |
| Exact Mass | 466.08 |
| IUPAC Name | (E)-3-[2-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]-N,N-bis(thiophen-2-ylmethyl)prop-2-enamide |
| SMILES | Cc1nc(COc2ccccc2/C=C/C(=O)N(Cc2cccs2)Cc2cccs2)cs1 |
| InChI | InChI=1S/C24H22N2O2S3/c1-18-25-20(17-31-18)16-28-23-9-3-2-6-19(23)10-11-24(27)26(14-21-7-4-12-29-21)15-22-8-5-13-30-22/h2-13,17H,14-16H2,1H3/b11-10+ |
| InChIKey | NNOIUVNWANSYAP-ZHACJKMWSA-N |
| XLogP | 6.40 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.65 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|