C20H14F5N3O2S — CID 26053287
(E)-3-[2-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]-N'-(2,3,4,5,6-pentafluorophenyl)prop-2-enehydrazide (PubChem CID 26053287) has the molecular formula C20H14F5N3O2S and a molecular weight of 455.41 g/mol. Its IUPAC name is (E)-3-[2-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]-N'-(2,3,4,5,6-pentafluorophenyl)prop-2-enehydrazide.
| Compound Name | (E)-3-[2-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]-N'-(2,3,4,5,6-pentafluorophenyl)prop-2-enehydrazide |
|---|---|
| PubChem CID | 26053287 |
| Molecular Formula | C20H14F5N3O2S |
| Molecular Weight | 455.41 g/mol |
| Exact Mass | 455.07 |
| IUPAC Name | (E)-3-[2-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]-N'-(2,3,4,5,6-pentafluorophenyl)prop-2-enehydrazide |
| SMILES | Cc1nc(COc2ccccc2/C=C/C(=O)NNc2c(F)c(F)c(F)c(F)c2F)cs1 |
| InChI | InChI=1S/C20H14F5N3O2S/c1-10-26-12(9-31-10)8-30-13-5-3-2-4-11(13)6-7-14(29)27-28-20-18(24)16(22)15(21)17(23)19(20)25/h2-7,9,28H,8H2,1H3,(H,27,29)/b7-6+ |
| InChIKey | YKGYGYWFNCSIMA-VOTSOKGWSA-N |
| XLogP | 4.88 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.41 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|