C21H19FN2O2S — CID 24594483
(E)-N-(4-fluoro-2-methylphenyl)-3-[2-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enamide (PubChem CID 24594483) has the molecular formula C21H19FN2O2S and a molecular weight of 382.46 g/mol. Its IUPAC name is (E)-N-(4-fluoro-2-methylphenyl)-3-[2-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enamide.
| Compound Name | (E)-N-(4-fluoro-2-methylphenyl)-3-[2-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 24594483 |
| Molecular Formula | C21H19FN2O2S |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | (E)-N-(4-fluoro-2-methylphenyl)-3-[2-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enamide |
| SMILES | Cc1nc(COc2ccccc2/C=C/C(=O)Nc2ccc(F)cc2C)cs1 |
| InChI | InChI=1S/C21H19FN2O2S/c1-14-11-17(22)8-9-19(14)24-21(25)10-7-16-5-3-4-6-20(16)26-12-18-13-27-15(2)23-18/h3-11,13H,12H2,1-2H3,(H,24,25)/b10-7+ |
| InChIKey | ILUNXJVEFZOEFH-JXMROGBWSA-N |
| XLogP | 5.13 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|