C23H19N3O2S — CID 24594556
(E)-3-[2-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]-N-quinolin-5-ylprop-2-enamide (PubChem CID 24594556) has the molecular formula C23H19N3O2S and a molecular weight of 401.49 g/mol. Its IUPAC name is (E)-3-[2-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]-N-quinolin-5-ylprop-2-enamide.
| Compound Name | (E)-3-[2-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]-N-quinolin-5-ylprop-2-enamide |
|---|---|
| PubChem CID | 24594556 |
| Molecular Formula | C23H19N3O2S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | (E)-3-[2-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]-N-quinolin-5-ylprop-2-enamide |
| SMILES | Cc1nc(COc2ccccc2/C=C/C(=O)Nc2cccc3ncccc23)cs1 |
| InChI | InChI=1S/C23H19N3O2S/c1-16-25-18(15-29-16)14-28-22-10-3-2-6-17(22)11-12-23(27)26-21-9-4-8-20-19(21)7-5-13-24-20/h2-13,15H,14H2,1H3,(H,26,27)/b12-11+ |
| InChIKey | CIXZDMNOQKNQEA-VAWYXSNFSA-N |
| XLogP | 5.23 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|