C23H25N3O4S2 — CID 16598565
(E)-3-[2-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]-N-[4-(propan-2-ylsulfamoyl)phenyl]prop-2-enamide (PubChem CID 16598565) has the molecular formula C23H25N3O4S2 and a molecular weight of 471.60 g/mol. Its IUPAC name is (E)-3-[2-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]-N-[4-(propan-2-ylsulfamoyl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-[2-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]-N-[4-(propan-2-ylsulfamoyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 16598565 |
| Molecular Formula | C23H25N3O4S2 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | (E)-3-[2-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]-N-[4-(propan-2-ylsulfamoyl)phenyl]prop-2-enamide |
| SMILES | Cc1nc(COc2ccccc2/C=C/C(=O)Nc2ccc(S(=O)(=O)NC(C)C)cc2)cs1 |
| InChI | InChI=1S/C23H25N3O4S2/c1-16(2)26-32(28,29)21-11-9-19(10-12-21)25-23(27)13-8-18-6-4-5-7-22(18)30-14-20-15-31-17(3)24-20/h4-13,15-16,26H,14H2,1-3H3,(H,25,27)/b13-8+ |
| InChIKey | ZHXJSESNGUCKNP-MDWZMJQESA-N |
| XLogP | 4.37 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|