C22H19N3O4S3 — CID 16590499
(E)-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)-3-[2-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enamide (PubChem CID 16590499) has the molecular formula C22H19N3O4S3 and a molecular weight of 485.61 g/mol. Its IUPAC name is (E)-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)-3-[2-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enamide.
| Compound Name | (E)-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)-3-[2-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 16590499 |
| Molecular Formula | C22H19N3O4S3 |
| Molecular Weight | 485.61 g/mol |
| Exact Mass | 485.05 |
| IUPAC Name | (E)-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)-3-[2-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enamide |
| SMILES | Cc1nc(COc2ccccc2/C=C/C(=O)Nc2nc3ccc(S(C)(=O)=O)cc3s2)cs1 |
| InChI | InChI=1S/C22H19N3O4S3/c1-14-23-16(13-30-14)12-29-19-6-4-3-5-15(19)7-10-21(26)25-22-24-18-9-8-17(32(2,27)28)11-20(18)31-22/h3-11,13H,12H2,1-2H3,(H,24,25,26)/b10-7+ |
| InChIKey | UKWDUAZMLPVOKO-JXMROGBWSA-N |
| XLogP | 4.70 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.61 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|