C15H12N2O3S3 — CID 1220189
(E)-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)-3-thiophen-2-ylprop-2-enamide (PubChem CID 1220189) has the molecular formula C15H12N2O3S3 and a molecular weight of 364.47 g/mol. Its IUPAC name is (E)-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)-3-thiophen-2-ylprop-2-enamide.
| Compound Name | (E)-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 1220189 |
| Molecular Formula | C15H12N2O3S3 |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.00 |
| IUPAC Name | (E)-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)-3-thiophen-2-ylprop-2-enamide |
| SMILES | CS(=O)(=O)c1ccc2nc(NC(=O)/C=C/c3cccs3)sc2c1 |
| InChI | InChI=1S/C15H12N2O3S3/c1-23(19,20)11-5-6-12-13(9-11)22-15(16-12)17-14(18)7-4-10-3-2-8-21-10/h2-9H,1H3,(H,16,17,18)/b7-4+ |
| InChIKey | XJWGOYBOOLSNRS-QPJJXVBHSA-N |
| XLogP | 3.41 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|