C18H12N2OS2 — CID 5169785
N-benzo[g][1,3]benzothiazol-2-yl-3-thiophen-2-ylprop-2-enamide (PubChem CID 5169785) has the molecular formula C18H12N2OS2 and a molecular weight of 336.44 g/mol. Its IUPAC name is N-benzo[g][1,3]benzothiazol-2-yl-3-thiophen-2-ylprop-2-enamide.
| Compound Name | N-benzo[g][1,3]benzothiazol-2-yl-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 5169785 |
| Molecular Formula | C18H12N2OS2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | N-benzo[g][1,3]benzothiazol-2-yl-3-thiophen-2-ylprop-2-enamide |
| SMILES | O=C(C=Cc1cccs1)Nc1nc2ccc3ccccc3c2s1 |
| InChI | InChI=1S/C18H12N2OS2/c21-16(10-8-13-5-3-11-22-13)20-18-19-15-9-7-12-4-1-2-6-14(12)17(15)23-18/h1-11H,(H,19,20,21) |
| InChIKey | HRESFBXXFJIHDB-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|