C21H20N2O4S2 — CID 43039021
(E)-N-(4-methylsulfonylphenyl)-3-[2-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enamide (PubChem CID 43039021) has the molecular formula C21H20N2O4S2 and a molecular weight of 428.54 g/mol. Its IUPAC name is (E)-N-(4-methylsulfonylphenyl)-3-[2-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enamide.
| Compound Name | (E)-N-(4-methylsulfonylphenyl)-3-[2-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 43039021 |
| Molecular Formula | C21H20N2O4S2 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | (E)-N-(4-methylsulfonylphenyl)-3-[2-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enamide |
| SMILES | Cc1nc(COc2ccccc2/C=C/C(=O)Nc2ccc(S(C)(=O)=O)cc2)cs1 |
| InChI | InChI=1S/C21H20N2O4S2/c1-15-22-18(14-28-15)13-27-20-6-4-3-5-16(20)7-12-21(24)23-17-8-10-19(11-9-17)29(2,25)26/h3-12,14H,13H2,1-2H3,(H,23,24)/b12-7+ |
| InChIKey | YELMYUGVQYWVLS-KPKJPENVSA-N |
| XLogP | 4.09 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|